C21H20N6O3 — CID 70837407
3-oxido-1-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzo[f]benzotriazol-3-ium-4,9-dione (PubChem CID 70837407) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-oxido-1-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzo[f]benzotriazol-3-ium-4,9-dione.
| Compound Name | 3-oxido-1-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzo[f]benzotriazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 70837407 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-oxido-1-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]benzo[f]benzotriazol-3-ium-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1n(CCN1CCN(c3ccccn3)CC1)n[n+]2[O-] |
| InChI | InChI=1S/C21H20N6O3/c28-20-15-5-1-2-6-16(15)21(29)19-18(20)26(23-27(19)30)14-11-24-9-12-25(13-10-24)17-7-3-4-8-22-17/h1-8H,9-14H2 |
| InChIKey | DZBAQPKUCOOMQP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|