C16H20N8O — CID 59541364
3-oxido-1-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]triazolo[4,5-d]pyrimidin-3-ium (PubChem CID 59541364) has the molecular formula C16H20N8O and a molecular weight of 340.39 g/mol. Its IUPAC name is 3-oxido-1-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]triazolo[4,5-d]pyrimidin-3-ium.
| Compound Name | 3-oxido-1-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]triazolo[4,5-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 59541364 |
| Molecular Formula | C16H20N8O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-oxido-1-[3-(4-pyridin-2-ylpiperazin-1-yl)propyl]triazolo[4,5-d]pyrimidin-3-ium |
| SMILES | [O-][n+]1nn(CCCN2CCN(c3ccccn3)CC2)c2cncnc21 |
| InChI | InChI=1S/C16H20N8O/c25-24-16-14(12-17-13-19-16)23(20-24)7-3-6-21-8-10-22(11-9-21)15-4-1-2-5-18-15/h1-2,4-5,12-13H,3,6-11H2 |
| InChIKey | DJMMBWAPEFFWEF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|