C22H24ClFN2O3 — CID 70840584
4-chloro-N-[2-[[4-[(1R,3R)-3-fluorocyclopentyl]oxybenzoyl]amino]ethyl]-3-methylbenzamide (PubChem CID 70840584) has the molecular formula C22H24ClFN2O3 and a molecular weight of 418.90 g/mol. Its IUPAC name is 4-chloro-N-[2-[[4-[(1R,3R)-3-fluorocyclopentyl]oxybenzoyl]amino]ethyl]-3-methylbenzamide.
| Compound Name | 4-chloro-N-[2-[[4-[(1R,3R)-3-fluorocyclopentyl]oxybenzoyl]amino]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 70840584 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-chloro-N-[2-[[4-[(1R,3R)-3-fluorocyclopentyl]oxybenzoyl]amino]ethyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCCNC(=O)c2ccc(O[C@@H]3CC[C@@H](F)C3)cc2)ccc1Cl |
| InChI | InChI=1S/C22H24ClFN2O3/c1-14-12-16(4-9-20(14)23)22(28)26-11-10-25-21(27)15-2-6-18(7-3-15)29-19-8-5-17(24)13-19/h2-4,6-7,9,12,17,19H,5,8,10-11,13H2,1H3,(H,25,27)(H,26,28)/t17-,19-/m1/s1 |
| InChIKey | XKXBTEFSFOSTSU-IEBWSBKVSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|