C14H16INO5 — CID 70840799
(2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(5-iodo-1H-indol-3-yl)oxy]oxane-3,4-diol (PubChem CID 70840799) has the molecular formula C14H16INO5 and a molecular weight of 405.19 g/mol. Its IUPAC name is (2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(5-iodo-1H-indol-3-yl)oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(5-iodo-1H-indol-3-yl)oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 70840799 |
| Molecular Formula | C14H16INO5 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | (2R,3R,4R,6S)-2-(hydroxymethyl)-6-[(5-iodo-1H-indol-3-yl)oxy]oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](Oc2c[nH]c3ccc(I)cc23)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16INO5/c15-7-1-2-9-8(3-7)11(5-16-9)20-13-4-10(18)14(19)12(6-17)21-13/h1-3,5,10,12-14,16-19H,4,6H2/t10-,12-,13-,14-/m1/s1 |
| InChIKey | KUBWBXZNXWEJKM-FMKGYKFTSA-N |
| XLogP | 0.98 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|