C20H24N4O2S — CID 70842611
tert-butyl N-[3-cyano-5-(6-piperidin-1-yl-3-pyridinyl)thiophen-2-yl]carbamate (PubChem CID 70842611) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is tert-butyl N-[3-cyano-5-(6-piperidin-1-yl-3-pyridinyl)thiophen-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-cyano-5-(6-piperidin-1-yl-3-pyridinyl)thiophen-2-yl]carbamate |
|---|---|
| PubChem CID | 70842611 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | tert-butyl N-[3-cyano-5-(6-piperidin-1-yl-3-pyridinyl)thiophen-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1sc(-c2ccc(N3CCCCC3)nc2)cc1C#N |
| InChI | InChI=1S/C20H24N4O2S/c1-20(2,3)26-19(25)23-18-15(12-21)11-16(27-18)14-7-8-17(22-13-14)24-9-5-4-6-10-24/h7-8,11,13H,4-6,9-10H2,1-3H3,(H,23,25) |
| InChIKey | NHHUJPIPOMUSQE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |