C9H11FN2O3 — CID 70845901
2-(4-fluoropiperidin-1-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 70845901) has the molecular formula C9H11FN2O3 and a molecular weight of 214.20 g/mol. Its IUPAC name is 2-(4-fluoropiperidin-1-yl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(4-fluoropiperidin-1-yl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 70845901 |
| Molecular Formula | C9H11FN2O3 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(4-fluoropiperidin-1-yl)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(N2CCC(F)CC2)n1 |
| InChI | InChI=1S/C9H11FN2O3/c10-6-1-3-12(4-2-6)9-11-7(5-15-9)8(13)14/h5-6H,1-4H2,(H,13,14) |
| InChIKey | DPGOISRIZWOTEH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |