C10H12N2O3 — CID 127020316
2-(4-methylidenepiperidin-1-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 127020316) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(4-methylidenepiperidin-1-yl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(4-methylidenepiperidin-1-yl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 127020316 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(4-methylidenepiperidin-1-yl)-1,3-oxazole-4-carboxylic acid |
| SMILES | C=C1CCN(c2nc(C(=O)O)co2)CC1 |
| InChI | InChI=1S/C10H12N2O3/c1-7-2-4-12(5-3-7)10-11-8(6-15-10)9(13)14/h6H,1-5H2,(H,13,14) |
| InChIKey | GTNSWIRTHBPONY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|