About 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid
2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid (PubChem CID 112692736) has the molecular formula C7H5N3O3
and a molecular weight of 179.14 g/mol. Its IUPAC name is 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid |
| PubChem CID | 112692736 |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(-n2ccnc2)n1 |
| InChI | InChI=1S/C7H5N3O3/c11-6(12)5-3-13-7(9-5)10-2-1-8-4-10/h1-4H,(H,11,12) |
| InChIKey | DFZKFQATTGGVEW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid (CID 112692736) is 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid is O=C(O)c1coc(-n2ccnc2)n1.
What is the InChIKey of 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid?
The InChIKey is DFZKFQATTGGVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3/c11-6(12)5-3-13-7(9-5)10-2-1-8-4-10/h1-4H,(H,11,12).
What are the key properties of 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid?
2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid has a molecular weight of 179.14 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-yl-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 112692736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).