C8H8N2O3 — CID 131096590
2-(2,5-dihydropyrrol-1-yl)-1,3-oxazole-4-carboxylic acid (PubChem CID 131096590) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-(2,5-dihydropyrrol-1-yl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(2,5-dihydropyrrol-1-yl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 131096590 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-(2,5-dihydropyrrol-1-yl)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(N2CC=CC2)n1 |
| InChI | InChI=1S/C8H8N2O3/c11-7(12)6-5-13-8(9-6)10-3-1-2-4-10/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | IVIPFZQHFJUYQV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|