C10H19NO3 — CID 70855036
(1S,3R,4R)-3-amino-4-(1-hydroxycyclopentyl)oxycyclopentan-1-ol (PubChem CID 70855036) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (1S,3R,4R)-3-amino-4-(1-hydroxycyclopentyl)oxycyclopentan-1-ol.
| Compound Name | (1S,3R,4R)-3-amino-4-(1-hydroxycyclopentyl)oxycyclopentan-1-ol |
|---|---|
| PubChem CID | 70855036 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (1S,3R,4R)-3-amino-4-(1-hydroxycyclopentyl)oxycyclopentan-1-ol |
| SMILES | N[C@@H]1C[C@H](O)C[C@H]1OC1(O)CCCC1 |
| InChI | InChI=1S/C10H19NO3/c11-8-5-7(12)6-9(8)14-10(13)3-1-2-4-10/h7-9,12-13H,1-6,11H2/t7-,8+,9+/m0/s1 |
| InChIKey | HCZMWEFSRZNWOO-DJLDLDEBSA-N |
| XLogP | 0.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|