About cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane
cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane (PubChem CID 143143276) has the molecular formula C8H20N2O2
and a molecular weight of 176.26 g/mol. Its IUPAC name is cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane.
Molecular Properties
| Compound Name | cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane |
| PubChem CID | 143143276 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane |
| SMILES | COC.N[C@@H]1CC(O)C[C@H](N)C1 |
| InChI | InChI=1S/C6H14N2O.C2H6O/c7-4-1-5(8)3-6(9)2-4;1-3-2/h4-6,9H,1-3,7-8H2;1-2H3/t4-,5+,6?; |
| InChIKey | UJFULGMUDBAKCP-FTEHNKOGSA-N |
| XLogP | -0.55 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane?
The IUPAC name of cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane (CID 143143276) is cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane.
What is the SMILES notation for cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane?
The canonical SMILES for cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane is COC.N[C@@H]1CC(O)C[C@H](N)C1.
What is the InChIKey of cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane?
The InChIKey is UJFULGMUDBAKCP-FTEHNKOGSA-N. The full InChI is InChI=1S/C6H14N2O.C2H6O/c7-4-1-5(8)3-6(9)2-4;1-3-2/h4-6,9H,1-3,7-8H2;1-2H3/t4-,5+,6?;.
What are the key properties of cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane?
cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane has a molecular weight of 176.26 g/mol, XLogP of -0.55, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3R,5S)-3,5-diaminocyclohexan-1-ol;methoxymethane is sourced from PubChem (CID 143143276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).