About [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate
[2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate (PubChem CID 70857125) has the molecular formula C23H28N2O3
and a molecular weight of 380.49 g/mol. Its IUPAC name is [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate.
Molecular Properties
| Compound Name | [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate |
| PubChem CID | 70857125 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCC(C)(C)NC2=NCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-4-5-14-27-19-12-10-17(11-13-19)22(26)28-16-23(2,3)25-21-20-9-7-6-8-18(20)15-24-21/h6-13H,4-5,14-16H2,1-3H3,(H,24,25) |
| InChIKey | MSUHWBPWNUNICQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate?
The IUPAC name of [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate (CID 70857125) is [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate.
What is the SMILES notation for [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate?
The canonical SMILES for [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate is CCCCOc1ccc(C(=O)OCC(C)(C)NC2=NCc3ccccc32)cc1.
What is the InChIKey of [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate?
The InChIKey is MSUHWBPWNUNICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O3/c1-4-5-14-27-19-12-10-17(11-13-19)22(26)28-16-23(2,3)25-21-20-9-7-6-8-18(20)15-24-21/h6-13H,4-5,14-16H2,1-3H3,(H,24,25).
What are the key properties of [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate?
[2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate has a molecular weight of 380.49 g/mol, XLogP of 4.35, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3H-isoindol-1-ylamino)-2-methylpropyl] 4-butoxybenzoate is sourced from PubChem (CID 70857125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).