C10H15N3O2 — CID 70859663
ethyl 3-(4-amino-6-methylpyrimidin-5-yl)propanoate (PubChem CID 70859663) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is ethyl 3-(4-amino-6-methylpyrimidin-5-yl)propanoate.
| Compound Name | ethyl 3-(4-amino-6-methylpyrimidin-5-yl)propanoate |
|---|---|
| PubChem CID | 70859663 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | ethyl 3-(4-amino-6-methylpyrimidin-5-yl)propanoate |
| SMILES | CCOC(=O)CCc1c(C)ncnc1N |
| InChI | InChI=1S/C10H15N3O2/c1-3-15-9(14)5-4-8-7(2)12-6-13-10(8)11/h6H,3-5H2,1-2H3,(H2,11,12,13) |
| InChIKey | HLIVRXSJLJTCQS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |