About 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one
1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one (PubChem CID 70863446) has the molecular formula C19H33NO
and a molecular weight of 291.48 g/mol. Its IUPAC name is 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one |
| PubChem CID | 70863446 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one |
| SMILES | CCC(=O)[C@@H]1C[C@@]2(CN1C(C)(C)CC)C(C)(C)C21CCC1 |
| InChI | InChI=1S/C19H33NO/c1-7-15(21)14-12-19(13-20(14)16(3,4)8-2)17(5,6)18(19)10-9-11-18/h14H,7-13H2,1-6H3/t14-,19+/m0/s1 |
| InChIKey | YEJUKUOHTUKQHG-IFXJQAMLSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one?
The IUPAC name of 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one (CID 70863446) is 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one.
What is the SMILES notation for 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one?
The canonical SMILES for 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one is CCC(=O)[C@@H]1C[C@@]2(CN1C(C)(C)CC)C(C)(C)C21CCC1.
What is the InChIKey of 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one?
The InChIKey is YEJUKUOHTUKQHG-IFXJQAMLSA-N. The full InChI is InChI=1S/C19H33NO/c1-7-15(21)14-12-19(13-20(14)16(3,4)8-2)17(5,6)18(19)10-9-11-18/h14H,7-13H2,1-6H3/t14-,19+/m0/s1.
What are the key properties of 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one?
1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one has a molecular weight of 291.48 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5R,8S)-10,10-dimethyl-7-(2-methylbutan-2-yl)-7-azadispiro[3.0.45.14]decan-8-yl]propan-1-one is sourced from PubChem (CID 70863446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).