C10H15F2N3O — CID 70864559
1-(5,5-difluorohexyl)pyrazole-3-carboxamide (PubChem CID 70864559) has the molecular formula C10H15F2N3O and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-(5,5-difluorohexyl)pyrazole-3-carboxamide.
| Compound Name | 1-(5,5-difluorohexyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 70864559 |
| Molecular Formula | C10H15F2N3O |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 1-(5,5-difluorohexyl)pyrazole-3-carboxamide |
| SMILES | CC(F)(F)CCCCn1ccc(C(N)=O)n1 |
| InChI | InChI=1S/C10H15F2N3O/c1-10(11,12)5-2-3-6-15-7-4-8(14-15)9(13)16/h4,7H,2-3,5-6H2,1H3,(H2,13,16) |
| InChIKey | IYRBQEKHBWCNNT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|