C17H27NO — CID 70864684
1-methyl-6-[(1R,4R)-1,3,7,7-tetramethyl-2-bicyclo[2.2.1]hept-2-enyl]piperidin-2-one (PubChem CID 70864684) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-methyl-6-[(1R,4R)-1,3,7,7-tetramethyl-2-bicyclo[2.2.1]hept-2-enyl]piperidin-2-one.
| Compound Name | 1-methyl-6-[(1R,4R)-1,3,7,7-tetramethyl-2-bicyclo[2.2.1]hept-2-enyl]piperidin-2-one |
|---|---|
| PubChem CID | 70864684 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-methyl-6-[(1R,4R)-1,3,7,7-tetramethyl-2-bicyclo[2.2.1]hept-2-enyl]piperidin-2-one |
| SMILES | CC1=C(C2CCCC(=O)N2C)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C17H27NO/c1-11-12-9-10-17(4,16(12,2)3)15(11)13-7-6-8-14(19)18(13)5/h12-13H,6-10H2,1-5H3/t12-,13?,17+/m1/s1 |
| InChIKey | VULDAHZUJOGMQP-KOHRXURCSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|