C37H49F3O — CID 70866880
5-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-6-fluorocyclohexa-1,3-dien-1-yl]-2-heptyloxane (PubChem CID 70866880) has the molecular formula C37H49F3O and a molecular weight of 566.79 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-6-fluorocyclohexa-1,3-dien-1-yl]-2-heptyloxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-6-fluorocyclohexa-1,3-dien-1-yl]-2-heptyloxane |
|---|---|
| PubChem CID | 70866880 |
| Molecular Formula | C37H49F3O |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-heptylphenyl)phenyl]-6-fluorocyclohexa-1,3-dien-1-yl]-2-heptyloxane |
| SMILES | CCCCCCCc1ccc(-c2ccc(C3=CC=C(C4CCC(CCCCCCC)OC4)C(F)C3)cc2)c(F)c1F |
| InChI | InChI=1S/C37H49F3O/c1-3-5-7-9-11-13-29-20-24-34(37(40)36(29)39)28-17-15-27(16-18-28)30-21-23-33(35(38)25-30)31-19-22-32(41-26-31)14-12-10-8-6-4-2/h15-18,20-21,23-24,31-32,35H,3-14,19,22,25-26H2,1-2H3 |
| InChIKey | NXUPGMNQGQXJQV-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|