C22H19N3O2 — CID 70868103
(3S,4R)-3-(4-azatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 70868103) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3S,4R)-3-(4-azatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S,4R)-3-(4-azatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70868103 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (3S,4R)-3-(4-azatricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)[C@@H](C2CN3CCc4cccc2c43)[C@@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H19N3O2/c26-21-18(15-10-23-17-7-2-1-5-13(15)17)19(22(27)24-21)16-11-25-9-8-12-4-3-6-14(16)20(12)25/h1-7,10,16,18-19,23H,8-9,11H2,(H,24,26,27)/t16?,18-,19-/m0/s1 |
| InChIKey | MGHCLNYGIHLPDA-MSYFUGIWSA-N |
| XLogP | 2.68 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|