C23H23N3O2 — CID 163810037
(3R,4R)-3-(1-ethyl-6,6-dimethylcyclopenta[b]pyrrol-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (PubChem CID 163810037) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (3R,4R)-3-(1-ethyl-6,6-dimethylcyclopenta[b]pyrrol-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3-(1-ethyl-6,6-dimethylcyclopenta[b]pyrrol-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 163810037 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (3R,4R)-3-(1-ethyl-6,6-dimethylcyclopenta[b]pyrrol-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| SMILES | CCn1cc([C@@H]2C(=O)NC(=O)[C@H]2c2c[nH]c3ccccc23)c2c1C(C)(C)C=C2 |
| InChI | InChI=1S/C23H23N3O2/c1-4-26-12-16(14-9-10-23(2,3)20(14)26)19-18(21(27)25-22(19)28)15-11-24-17-8-6-5-7-13(15)17/h5-12,18-19,24H,4H2,1-3H3,(H,25,27,28)/t18-,19-/m0/s1 |
| InChIKey | NMKZRBCZMNEGON-OALUTQOASA-N |
| XLogP | 3.82 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|