C13H25N3 — CID 70868554
4,5-diethyl-5,7,11-triazatricyclo[6.4.0.02,6]dodecane (PubChem CID 70868554) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 4,5-diethyl-5,7,11-triazatricyclo[6.4.0.02,6]dodecane.
| Compound Name | 4,5-diethyl-5,7,11-triazatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 70868554 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 4,5-diethyl-5,7,11-triazatricyclo[6.4.0.02,6]dodecane |
| SMILES | CCC1CC2C3CNCCC3NC2N1CC |
| InChI | InChI=1S/C13H25N3/c1-3-9-7-10-11-8-14-6-5-12(11)15-13(10)16(9)4-2/h9-15H,3-8H2,1-2H3 |
| InChIKey | WHNCOSXPRMEDJQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |