About 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate
2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate (PubChem CID 70871771) has the molecular formula C12H22N2O4
and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate.
Molecular Properties
| Compound Name | 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate |
| PubChem CID | 70871771 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCN(C[C@@H]1CC[C@@H](N)CO1)C(C)=O |
| InChI | InChI=1S/C12H22N2O4/c1-9(15)14(5-6-17-10(2)16)7-12-4-3-11(13)8-18-12/h11-12H,3-8,13H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | HRGHJADVBRHDLQ-NEPJUHHUSA-N |
| XLogP | -0.10 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate?
The IUPAC name of 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate (CID 70871771) is 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate.
What is the SMILES notation for 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate?
The canonical SMILES for 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate is CC(=O)OCCN(C[C@@H]1CC[C@@H](N)CO1)C(C)=O.
What is the InChIKey of 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate?
The InChIKey is HRGHJADVBRHDLQ-NEPJUHHUSA-N. The full InChI is InChI=1S/C12H22N2O4/c1-9(15)14(5-6-17-10(2)16)7-12-4-3-11(13)8-18-12/h11-12H,3-8,13H2,1-2H3/t11-,12+/m1/s1.
What are the key properties of 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate?
2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate has a molecular weight of 258.32 g/mol, XLogP of -0.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[acetyl-[[(2S,5R)-5-aminooxan-2-yl]methyl]amino]ethyl acetate is sourced from PubChem (CID 70871771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).