C7H11N3O2 — CID 70871864
(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine (PubChem CID 70871864) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is (3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine.
| Compound Name | (3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine |
|---|---|
| PubChem CID | 70871864 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine |
| SMILES | N[C@@H]1CC[C@@H](c2ncon2)OC1 |
| InChI | InChI=1S/C7H11N3O2/c8-5-1-2-6(11-3-5)7-9-4-12-10-7/h4-6H,1-3,8H2/t5-,6+/m1/s1 |
| InChIKey | NZZSAXGILBEKRM-RITPCOANSA-N |
| XLogP | 0.25 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |