C12H19N3O4 — CID 70913907
tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate (PubChem CID 70913907) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 70913907 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl N-[(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](c2ncon2)OC1 |
| InChI | InChI=1S/C12H19N3O4/c1-12(2,3)19-11(16)14-8-4-5-9(17-6-8)10-13-7-18-15-10/h7-9H,4-6H2,1-3H3,(H,14,16)/t8-,9+/m1/s1 |
| InChIKey | USILJOMJNGMMFJ-BDAKNGLRSA-N |
| XLogP | 1.81 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |