C24H27BrN3O6S+ — CID 7088955
2-[[6-bromo-3-ethoxycarbonyl-2-[(4-nitrobenzoyl)amino]-1-benzothiophen-7-yl]oxy]ethyl-diethylazanium (PubChem CID 7088955) has the molecular formula C24H27BrN3O6S+ and a molecular weight of 565.47 g/mol. Its IUPAC name is 2-[[6-bromo-3-ethoxycarbonyl-2-[(4-nitrobenzoyl)amino]-1-benzothiophen-7-yl]oxy]ethyl-diethylazanium.
| Compound Name | 2-[[6-bromo-3-ethoxycarbonyl-2-[(4-nitrobenzoyl)amino]-1-benzothiophen-7-yl]oxy]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7088955 |
| Molecular Formula | C24H27BrN3O6S+ |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 2-[[6-bromo-3-ethoxycarbonyl-2-[(4-nitrobenzoyl)amino]-1-benzothiophen-7-yl]oxy]ethyl-diethylazanium |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc([N+](=O)[O-])cc2)sc2c(OCC[NH+](CC)CC)c(Br)ccc12 |
| InChI | InChI=1S/C24H26BrN3O6S/c1-4-27(5-2)13-14-34-20-18(25)12-11-17-19(24(30)33-6-3)23(35-21(17)20)26-22(29)15-7-9-16(10-8-15)28(31)32/h7-12H,4-6,13-14H2,1-3H3,(H,26,29)/p+1 |
| InChIKey | KWFDOTRLAGXFQP-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|