C20H26N2O5 — CID 70893666
2-[(2S)-1-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 70893666) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[(2S)-1-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-[(2S)-1-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 70893666 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-[(2S)-1-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CO[C@H]1CN(C(=O)[C@@H](CC(C)C)c2ccccc2C(N)=O)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C20H26N2O5/c1-11(2)8-14(12-6-4-5-7-13(12)19(21)24)20(25)22-9-16(26-3)18-17(22)15(23)10-27-18/h4-7,11,14,16-18H,8-10H2,1-3H3,(H2,21,24)/t14-,16-,17+,18+/m0/s1 |
| InChIKey | VPGVTEKAUUTWBD-DZJNRPSUSA-N |
| XLogP | 1.11 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |