C22H25ClN6O4 — CID 140567030
2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 140567030) has the molecular formula C22H25ClN6O4 and a molecular weight of 472.93 g/mol. Its IUPAC name is 2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | 2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 140567030 |
| Molecular Formula | C22H25ClN6O4 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | NC(=O)c1cccc(-n2cnnn2)c1[C@@H](C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C22H25ClN6O4/c23-14-9-28(19-16(30)10-33-20(14)19)22(32)17(12-5-2-1-3-6-12)18-13(21(24)31)7-4-8-15(18)29-11-25-26-27-29/h4,7-8,11-12,14,17,19-20H,1-3,5-6,9-10H2,(H2,24,31)/t14-,17-,19+,20+/m0/s1 |
| InChIKey | NDDBJYAQJVJZNF-GIPAHHNCSA-N |
| XLogP | 1.21 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|