C24H23IO3 — CID 70895690
6-(4-iodophenyl)-2,2-dimethyl-4-naphthalen-2-yl-6-oxohexanoic acid (PubChem CID 70895690) has the molecular formula C24H23IO3 and a molecular weight of 486.35 g/mol. Its IUPAC name is 6-(4-iodophenyl)-2,2-dimethyl-4-naphthalen-2-yl-6-oxohexanoic acid.
| Compound Name | 6-(4-iodophenyl)-2,2-dimethyl-4-naphthalen-2-yl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 70895690 |
| Molecular Formula | C24H23IO3 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 6-(4-iodophenyl)-2,2-dimethyl-4-naphthalen-2-yl-6-oxohexanoic acid |
| SMILES | CC(C)(CC(CC(=O)c1ccc(I)cc1)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C24H23IO3/c1-24(2,23(27)28)15-20(14-22(26)17-9-11-21(25)12-10-17)19-8-7-16-5-3-4-6-18(16)13-19/h3-13,20H,14-15H2,1-2H3,(H,27,28) |
| InChIKey | HNTGUZHNOAVPDX-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|