C13H20O7 — CID 70896745
diethyl (2R,3R,5R)-5-acetyloxy-3-methyloxolane-2,3-dicarboxylate (PubChem CID 70896745) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is diethyl (2R,3R,5R)-5-acetyloxy-3-methyloxolane-2,3-dicarboxylate.
| Compound Name | diethyl (2R,3R,5R)-5-acetyloxy-3-methyloxolane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 70896745 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | diethyl (2R,3R,5R)-5-acetyloxy-3-methyloxolane-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H](OC(C)=O)C[C@@]1(C)C(=O)OCC |
| InChI | InChI=1S/C13H20O7/c1-5-17-11(15)10-13(4,12(16)18-6-2)7-9(20-10)19-8(3)14/h9-10H,5-7H2,1-4H3/t9-,10-,13+/m0/s1 |
| InChIKey | VULYCAAWJGGYFP-OUJBWJOFSA-N |
| XLogP | 0.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|