C12H13ClN2O2 — CID 70901273
ethyl 2-(4-chlorophenyl)-3,4-dihydropyrazole-3-carboxylate (PubChem CID 70901273) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-3,4-dihydropyrazole-3-carboxylate.
| Compound Name | ethyl 2-(4-chlorophenyl)-3,4-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 70901273 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-3,4-dihydropyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1CC=NN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-2-17-12(16)11-7-8-14-15(11)10-5-3-9(13)4-6-10/h3-6,8,11H,2,7H2,1H3 |
| InChIKey | SLZYFZPQHBFPGO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |