C20H16ClN5 — CID 70901842
4-(2-chlorophenyl)-N-[(3-pyridin-4-yl-1H-pyrazol-5-yl)methyl]pyridin-2-amine (PubChem CID 70901842) has the molecular formula C20H16ClN5 and a molecular weight of 361.84 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-[(3-pyridin-4-yl-1H-pyrazol-5-yl)methyl]pyridin-2-amine.
| Compound Name | 4-(2-chlorophenyl)-N-[(3-pyridin-4-yl-1H-pyrazol-5-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 70901842 |
| Molecular Formula | C20H16ClN5 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-(2-chlorophenyl)-N-[(3-pyridin-4-yl-1H-pyrazol-5-yl)methyl]pyridin-2-amine |
| SMILES | Clc1ccccc1-c1ccnc(NCc2cc(-c3ccncc3)n[nH]2)c1 |
| InChI | InChI=1S/C20H16ClN5/c21-18-4-2-1-3-17(18)15-7-10-23-20(11-15)24-13-16-12-19(26-25-16)14-5-8-22-9-6-14/h1-12H,13H2,(H,23,24)(H,25,26) |
| InChIKey | YOGZRTUWTLHGCD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |