C28H33N9O2S — CID 70902252
1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea (PubChem CID 70902252) has the molecular formula C28H33N9O2S and a molecular weight of 559.70 g/mol. Its IUPAC name is 1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea.
| Compound Name | 1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea |
|---|---|
| PubChem CID | 70902252 |
| Molecular Formula | C28H33N9O2S |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 1-[5-[2-[[8-[4-[3-(dimethylamino)propoxy]phenyl]-7H-purin-6-yl]amino]ethyl]-4,5-dihydro-1,3-thiazol-2-yl]-3-phenylurea |
| SMILES | CN(C)CCCOc1ccc(-c2nc3ncnc(NCCC4CN=C(NC(=O)Nc5ccccc5)S4)c3[nH]2)cc1 |
| InChI | InChI=1S/C28H33N9O2S/c1-37(2)15-6-16-39-21-11-9-19(10-12-21)24-34-23-25(31-18-32-26(23)35-24)29-14-13-22-17-30-28(40-22)36-27(38)33-20-7-4-3-5-8-20/h3-5,7-12,18,22H,6,13-17H2,1-2H3,(H2,30,33,36,38)(H2,29,31,32,34,35) |
| InChIKey | SYRRPLAAEXRGMQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|