C32H37N7O — CID 70905180
1-(2-cyclohexa-1,5-dien-1-ylquinolin-7-yl)-3-[3-(3-morpholin-4-ylpropylamino)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 70905180) has the molecular formula C32H37N7O and a molecular weight of 535.70 g/mol. Its IUPAC name is 1-(2-cyclohexa-1,5-dien-1-ylquinolin-7-yl)-3-[3-(3-morpholin-4-ylpropylamino)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-(2-cyclohexa-1,5-dien-1-ylquinolin-7-yl)-3-[3-(3-morpholin-4-ylpropylamino)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 70905180 |
| Molecular Formula | C32H37N7O |
| Molecular Weight | 535.70 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | 1-(2-cyclohexa-1,5-dien-1-ylquinolin-7-yl)-3-[3-(3-morpholin-4-ylpropylamino)cyclobutyl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CC(NCCCN4CCOCC4)C3)nc(-c3ccc4ccc(C5=CCCC=C5)nc4c3)c12 |
| InChI | InChI=1S/C32H37N7O/c33-31-30-29(24-8-7-23-9-10-27(36-28(23)21-24)22-5-2-1-3-6-22)37-32(39(30)14-12-35-31)25-19-26(20-25)34-11-4-13-38-15-17-40-18-16-38/h2,5-10,12,14,21,25-26,34H,1,3-4,11,13,15-20H2,(H2,33,35) |
| InChIKey | GONYQXJXBSTULL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.70 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|