C20H27NO4 — CID 70907540
(4aS,7S,7aR,12bS)-7-ethoxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 70907540) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (4aS,7S,7aR,12bS)-7-ethoxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4aS,7S,7aR,12bS)-7-ethoxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 70907540 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (4aS,7S,7aR,12bS)-7-ethoxy-9-(hydroxymethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | CCO[C@H]1CC[C@@]2(O)C3Cc4ccc(CO)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C20H27NO4/c1-3-24-14-6-7-20(23)15-10-12-4-5-13(11-22)17-16(12)19(20,18(14)25-17)8-9-21(15)2/h4-5,14-15,18,22-23H,3,6-11H2,1-2H3/t14-,15?,18-,19-,20+/m0/s1 |
| InChIKey | XCLFQUVCDPLKEF-WICKCUDESA-N |
| XLogP | 1.37 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |