C27H41NO8 — CID 154732844
(4aS,7S,7aR,12bS)-9-(hydroxymethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 154732844) has the molecular formula C27H41NO8 and a molecular weight of 507.62 g/mol. Its IUPAC name is (4aS,7S,7aR,12bS)-9-(hydroxymethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4aS,7S,7aR,12bS)-9-(hydroxymethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 154732844 |
| Molecular Formula | C27H41NO8 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (4aS,7S,7aR,12bS)-9-(hydroxymethyl)-7-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | COCCOCCOCCOCCO[C@H]1CC[C@@]2(O)C3Cc4ccc(CO)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C27H41NO8/c1-28-8-7-26-23-19-3-4-20(18-29)24(23)36-25(26)21(5-6-27(26,30)22(28)17-19)35-16-15-34-14-13-33-12-11-32-10-9-31-2/h3-4,21-22,25,29-30H,5-18H2,1-2H3/t21-,22?,25-,26-,27+/m0/s1 |
| InChIKey | IEXCMLLRCWULIS-WMFZPKMRSA-N |
| XLogP | 1.04 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|