C19H23N3O4 — CID 70911574
ethyl 3-[(E)-3-(dimethylamino)prop-2-enoyl]-1-[(3-methoxyphenyl)methyl]pyrazole-5-carboxylate (PubChem CID 70911574) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 3-[(E)-3-(dimethylamino)prop-2-enoyl]-1-[(3-methoxyphenyl)methyl]pyrazole-5-carboxylate.
| Compound Name | ethyl 3-[(E)-3-(dimethylamino)prop-2-enoyl]-1-[(3-methoxyphenyl)methyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 70911574 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | ethyl 3-[(E)-3-(dimethylamino)prop-2-enoyl]-1-[(3-methoxyphenyl)methyl]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)/C=C/N(C)C)nn1Cc1cccc(OC)c1 |
| InChI | InChI=1S/C19H23N3O4/c1-5-26-19(24)17-12-16(18(23)9-10-21(2)3)20-22(17)13-14-7-6-8-15(11-14)25-4/h6-12H,5,13H2,1-4H3/b10-9+ |
| InChIKey | DVYRBXAIDBMSKF-MDZDMXLPSA-N |
| XLogP | 2.37 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|