C7H11NO2S2 — CID 70912750
4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butanoic acid (PubChem CID 70912750) has the molecular formula C7H11NO2S2 and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butanoic acid.
| Compound Name | 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 70912750 |
| Molecular Formula | C7H11NO2S2 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butanoic acid |
| SMILES | O=C(O)CCCSC1=NCCS1 |
| InChI | InChI=1S/C7H11NO2S2/c9-6(10)2-1-4-11-7-8-3-5-12-7/h1-5H2,(H,9,10) |
| InChIKey | JGFICTWUQFQKIY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|