C18H26N2O5 — CID 70913910
benzyl N-[(3R,6S)-6-[2-methoxyethyl(methyl)carbamoyl]oxan-3-yl]carbamate (PubChem CID 70913910) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is benzyl N-[(3R,6S)-6-[2-methoxyethyl(methyl)carbamoyl]oxan-3-yl]carbamate.
| Compound Name | benzyl N-[(3R,6S)-6-[2-methoxyethyl(methyl)carbamoyl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 70913910 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | benzyl N-[(3R,6S)-6-[2-methoxyethyl(methyl)carbamoyl]oxan-3-yl]carbamate |
| SMILES | COCCN(C)C(=O)[C@@H]1CC[C@@H](NC(=O)OCc2ccccc2)CO1 |
| InChI | InChI=1S/C18H26N2O5/c1-20(10-11-23-2)17(21)16-9-8-15(13-24-16)19-18(22)25-12-14-6-4-3-5-7-14/h3-7,15-16H,8-13H2,1-2H3,(H,19,22)/t15-,16+/m1/s1 |
| InChIKey | TVIBAFCTKOWWKP-CVEARBPZSA-N |
| XLogP | 1.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |