C16H19N5O6 — CID 70913988
1-hydroxy-N-[2-[2-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]ethylamino]ethyl]-6-oxopyridine-2-carboxamide (PubChem CID 70913988) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-hydroxy-N-[2-[2-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]ethylamino]ethyl]-6-oxopyridine-2-carboxamide.
| Compound Name | 1-hydroxy-N-[2-[2-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]ethylamino]ethyl]-6-oxopyridine-2-carboxamide |
|---|---|
| PubChem CID | 70913988 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-hydroxy-N-[2-[2-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]ethylamino]ethyl]-6-oxopyridine-2-carboxamide |
| SMILES | O=C(NCCNCCNC(=O)c1cccc(=O)n1O)c1cccc(=O)n1O |
| InChI | InChI=1S/C16H19N5O6/c22-13-5-1-3-11(20(13)26)15(24)18-9-7-17-8-10-19-16(25)12-4-2-6-14(23)21(12)27/h1-6,17,26-27H,7-10H2,(H,18,24)(H,19,25) |
| InChIKey | DFKPRFSBADIBRW-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|