C40H47N9O15 — CID 121438544
methyl 4-[2,5-bis[(1-hydroxy-6-oxopyridine-2-carbonyl)-[3-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]propyl]amino]pentanoylamino]butanoate (PubChem CID 121438544) has the molecular formula C40H47N9O15 and a molecular weight of 893.86 g/mol. Its IUPAC name is methyl 4-[2,5-bis[(1-hydroxy-6-oxopyridine-2-carbonyl)-[3-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]propyl]amino]pentanoylamino]butanoate.
| Compound Name | methyl 4-[2,5-bis[(1-hydroxy-6-oxopyridine-2-carbonyl)-[3-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]propyl]amino]pentanoylamino]butanoate |
|---|---|
| PubChem CID | 121438544 |
| Molecular Formula | C40H47N9O15 |
| Molecular Weight | 893.86 g/mol |
| Exact Mass | 893.32 |
| IUPAC Name | methyl 4-[2,5-bis[(1-hydroxy-6-oxopyridine-2-carbonyl)-[3-[(1-hydroxy-6-oxopyridine-2-carbonyl)amino]propyl]amino]pentanoylamino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C(CCCN(CCCNC(=O)c1cccc(=O)n1O)C(=O)c1cccc(=O)n1O)N(CCCNC(=O)c1cccc(=O)n1O)C(=O)c1cccc(=O)n1O |
| InChI | InChI=1S/C40H47N9O15/c1-64-35(54)19-6-20-41-36(55)26(45(40(59)30-13-5-18-34(53)49(30)63)25-9-22-43-38(57)28-11-3-16-32(51)47(28)61)14-7-23-44(39(58)29-12-4-17-33(52)48(29)62)24-8-21-42-37(56)27-10-2-15-31(50)46(27)60/h2-5,10-13,15-18,26,60-63H,6-9,14,19-25H2,1H3,(H,41,55)(H,42,56)(H,43,57) |
| InChIKey | BCRZEKAOWQVRPL-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 323.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.86 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|