C12H16ClNO4 — CID 82110491
methyl 4-[[5-(1-chloroethyl)furan-2-carbonyl]amino]butanoate (PubChem CID 82110491) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is methyl 4-[[5-(1-chloroethyl)furan-2-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[5-(1-chloroethyl)furan-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 82110491 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | methyl 4-[[5-(1-chloroethyl)furan-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccc(C(C)Cl)o1 |
| InChI | InChI=1S/C12H16ClNO4/c1-8(13)9-5-6-10(18-9)12(16)14-7-3-4-11(15)17-2/h5-6,8H,3-4,7H2,1-2H3,(H,14,16) |
| InChIKey | VDVCGVYUTVELLW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|