C29H35FN5O10P — CID 70917960
ditert-butyl [(5R)-3-[3-fluoro-4-[6-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl phosphate (PubChem CID 70917960) has the molecular formula C29H35FN5O10P and a molecular weight of 663.60 g/mol. Its IUPAC name is ditert-butyl [(5R)-3-[3-fluoro-4-[6-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl phosphate.
| Compound Name | ditert-butyl [(5R)-3-[3-fluoro-4-[6-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl phosphate |
|---|---|
| PubChem CID | 70917960 |
| Molecular Formula | C29H35FN5O10P |
| Molecular Weight | 663.60 g/mol |
| Exact Mass | 663.21 |
| IUPAC Name | ditert-butyl [(5R)-3-[3-fluoro-4-[6-[[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl]oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OC[C@H]1CN(c2ccc(-c3ccc(O[C@@H]4COc5nc([N+](=O)[O-])cn5C4)nc3)c(F)c2)C(=O)O1)OC(C)(C)C |
| InChI | InChI=1S/C29H35FN5O10P/c1-28(2,3)44-46(39,45-29(4,5)6)41-17-21-14-34(27(36)43-21)19-8-9-22(23(30)11-19)18-7-10-25(31-12-18)42-20-13-33-15-24(35(37)38)32-26(33)40-16-20/h7-12,15,20-21H,13-14,16-17H2,1-6H3/t20-,21+/m0/s1 |
| InChIKey | RBIBACPJCLMPQB-LEWJYISDSA-N |
| XLogP | 5.91 |
| TPSA | 166.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.60 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|