C21H19FN5O10P — CID 68545922
[3-[3-fluoro-4-[6-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate (PubChem CID 68545922) has the molecular formula C21H19FN5O10P and a molecular weight of 551.38 g/mol. Its IUPAC name is [3-[3-fluoro-4-[6-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate.
| Compound Name | [3-[3-fluoro-4-[6-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 68545922 |
| Molecular Formula | C21H19FN5O10P |
| Molecular Weight | 551.38 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | [3-[3-fluoro-4-[6-[(2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl)oxy]-3-pyridinyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl dihydrogen phosphate |
| SMILES | O=C1OC(COP(=O)(O)O)CN1c1ccc(-c2ccc(OC3COc4nc([N+](=O)[O-])cn4C3)nc2)c(F)c1 |
| InChI | InChI=1S/C21H19FN5O10P/c22-17-5-13(26-8-15(37-21(26)28)11-35-38(31,32)33)2-3-16(17)12-1-4-19(23-6-12)36-14-7-25-9-18(27(29)30)24-20(25)34-10-14/h1-6,9,14-15H,7-8,10-11H2,(H2,31,32,33) |
| InChIKey | DTLYMLJAUJLKPV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 188.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|