About CID 68542913
CID 68542913 (PubChem CID 68542913) has the molecular formula C26H29FN6O7Si
and a molecular weight of 584.64 g/mol.
Molecular Properties
| Compound Name | CID 68542913 |
| PubChem CID | 68542913 |
| Molecular Formula | C26H29FN6O7Si |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)[C@H]1CN(c2ccc(-c3cnc(O[C@@H]4COc5nc([N+](=O)[O-])cn5C4)nc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C26H29FN6O7Si/c1-25(2,3)41-40-26(4,5)20-12-32(24(34)39-20)16-6-7-18(19(27)8-16)15-9-28-22(29-10-15)38-17-11-31-13-21(33(35)36)30-23(31)37-14-17/h6-10,13,17,20H,11-12,14H2,1-5H3/t17-,20+/m0/s1 |
| InChIKey | RTZARVUCEXKOBL-FXAWDEMLSA-N |
| XLogP | 4.19 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 68542913 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68542913?
The IUPAC name of CID 68542913 (CID 68542913) is not available.
What is the SMILES notation for CID 68542913?
The canonical SMILES for CID 68542913 is CC(C)(C)[Si]OC(C)(C)[C@H]1CN(c2ccc(-c3cnc(O[C@@H]4COc5nc([N+](=O)[O-])cn5C4)nc3)c(F)c2)C(=O)O1.
What is the InChIKey of CID 68542913?
The InChIKey is RTZARVUCEXKOBL-FXAWDEMLSA-N. The full InChI is InChI=1S/C26H29FN6O7Si/c1-25(2,3)41-40-26(4,5)20-12-32(24(34)39-20)16-6-7-18(19(27)8-16)15-9-28-22(29-10-15)38-17-11-31-13-21(33(35)36)30-23(31)37-14-17/h6-10,13,17,20H,11-12,14H2,1-5H3/t17-,20+/m0/s1.
What are the key properties of CID 68542913?
CID 68542913 has a molecular weight of 584.64 g/mol, XLogP of 4.19, 8 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68542913 is sourced from PubChem (CID 68542913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).