C26H29FN6O7Si — CID 68542913
CID 68542913 (PubChem CID 68542913) has the molecular formula C26H29FN6O7Si and a molecular weight of 584.64 g/mol.
| Compound Name | CID 68542913 |
|---|---|
| PubChem CID | 68542913 |
| Molecular Formula | C26H29FN6O7Si |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)[C@H]1CN(c2ccc(-c3cnc(O[C@@H]4COc5nc([N+](=O)[O-])cn5C4)nc3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C26H29FN6O7Si/c1-25(2,3)41-40-26(4,5)20-12-32(24(34)39-20)16-6-7-18(19(27)8-16)15-9-28-22(29-10-15)38-17-11-31-13-21(33(35)36)30-23(31)37-14-17/h6-10,13,17,20H,11-12,14H2,1-5H3/t17-,20+/m0/s1 |
| InChIKey | RTZARVUCEXKOBL-FXAWDEMLSA-N |
| XLogP | 4.19 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|