C25H32ClN5O7S — CID 70921806
[(7E)-4-[(4-chlorophenyl)sulfamoylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate (PubChem CID 70921806) has the molecular formula C25H32ClN5O7S and a molecular weight of 582.08 g/mol. Its IUPAC name is [(7E)-4-[(4-chlorophenyl)sulfamoylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate.
| Compound Name | [(7E)-4-[(4-chlorophenyl)sulfamoylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
|---|---|
| PubChem CID | 70921806 |
| Molecular Formula | C25H32ClN5O7S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | [(7E)-4-[(4-chlorophenyl)sulfamoylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
| SMILES | NC(=O)OC1CCCCC/C=C/C2CC2(C(=O)NS(=O)(=O)Nc2ccc(Cl)cc2)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C25H32ClN5O7S/c26-17-10-12-18(13-11-17)29-39(36,37)30-23(34)25-15-16(25)7-4-2-1-3-5-9-20(38-24(27)35)22(33)31-14-6-8-19(31)21(32)28-25/h4,7,10-13,16,19-20,29H,1-3,5-6,8-9,14-15H2,(H2,27,35)(H,28,32)(H,30,34)/b7-4+ |
| InChIKey | DGIHFYCMAWJWPJ-QPJJXVBHSA-N |
| XLogP | 1.96 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|