C23H35N5O7S — CID 67105720
[(7Z)-4-(cyclobutylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate (PubChem CID 67105720) has the molecular formula C23H35N5O7S and a molecular weight of 525.63 g/mol. Its IUPAC name is [(7Z)-4-(cyclobutylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate.
| Compound Name | [(7Z)-4-(cyclobutylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
|---|---|
| PubChem CID | 67105720 |
| Molecular Formula | C23H35N5O7S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | [(7Z)-4-(cyclobutylsulfamoylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
| SMILES | NC(=O)OC1CCCCC/C=C\C2CC2(C(=O)NS(=O)(=O)NC2CCC2)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C23H35N5O7S/c24-22(32)35-18-12-5-3-1-2-4-8-15-14-23(15,21(31)27-36(33,34)26-16-9-6-10-16)25-19(29)17-11-7-13-28(17)20(18)30/h4,8,15-18,26H,1-3,5-7,9-14H2,(H2,24,32)(H,25,29)(H,27,31)/b8-4- |
| InChIKey | MXIIVBYHDQBBFJ-YWEYNIOJSA-N |
| XLogP | 0.34 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|