C25H31FN4O7S — CID 67120270
[4-[(2-fluorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate (PubChem CID 67120270) has the molecular formula C25H31FN4O7S and a molecular weight of 550.61 g/mol. Its IUPAC name is [4-[(2-fluorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate.
| Compound Name | [4-[(2-fluorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
|---|---|
| PubChem CID | 67120270 |
| Molecular Formula | C25H31FN4O7S |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | [4-[(2-fluorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
| SMILES | NC(=O)OC1CCCCCC=CC2CC2(C(=O)NS(=O)(=O)c2ccccc2F)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C25H31FN4O7S/c26-17-10-6-7-13-20(17)38(35,36)29-23(33)25-15-16(25)9-4-2-1-3-5-12-19(37-24(27)34)22(32)30-14-8-11-18(30)21(31)28-25/h4,6-7,9-10,13,16,18-19H,1-3,5,8,11-12,14-15H2,(H2,27,34)(H,28,31)(H,29,33) |
| InChIKey | MDGHKYQNUFOBLP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|