C26H34N4O5 — CID 67106095
[4-(benzylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate (PubChem CID 67106095) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is [4-(benzylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate.
| Compound Name | [4-(benzylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
|---|---|
| PubChem CID | 67106095 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [4-(benzylcarbamoyl)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] carbamate |
| SMILES | NC(=O)OC1CCCCCC=CC2CC2(C(=O)NCc2ccccc2)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C26H34N4O5/c27-25(34)35-21-14-8-3-1-2-7-12-19-16-26(19,24(33)28-17-18-10-5-4-6-11-18)29-22(31)20-13-9-15-30(20)23(21)32/h4-7,10-12,19-21H,1-3,8-9,13-17H2,(H2,27,34)(H,28,33)(H,29,31) |
| InChIKey | AIQYRERBYCEPOL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|