C29H39ClN4O7S — CID 90847808
[(1S,4R,6S,14S)-4-[(2-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate (PubChem CID 90847808) has the molecular formula C29H39ClN4O7S and a molecular weight of 623.17 g/mol. Its IUPAC name is [(1S,4R,6S,14S)-4-[(2-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate.
| Compound Name | [(1S,4R,6S,14S)-4-[(2-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90847808 |
| Molecular Formula | C29H39ClN4O7S |
| Molecular Weight | 623.17 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | [(1S,4R,6S,14S)-4-[(2-chlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H]1CCCCCC=C[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)c2ccccc2Cl)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C29H39ClN4O7S/c1-28(2,3)32-27(38)41-22-15-8-6-4-5-7-12-19-18-29(19,31-24(35)21-14-11-17-34(21)25(22)36)26(37)33-42(39,40)23-16-10-9-13-20(23)30/h7,9-10,12-13,16,19,21-22H,4-6,8,11,14-15,17-18H2,1-3H3,(H,31,35)(H,32,38)(H,33,37)/t19-,21+,22+,29-/m1/s1 |
| InChIKey | FBXYKECYJGDNKG-LIWGRTDTSA-N |
| XLogP | 3.42 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|