C30H42N4O5 — CID 90896832
[(1S,4R,6S,14S)-4-[(4-methylphenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate (PubChem CID 90896832) has the molecular formula C30H42N4O5 and a molecular weight of 538.69 g/mol. Its IUPAC name is [(1S,4R,6S,14S)-4-[(4-methylphenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate.
| Compound Name | [(1S,4R,6S,14S)-4-[(4-methylphenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90896832 |
| Molecular Formula | C30H42N4O5 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | [(1S,4R,6S,14S)-4-[(4-methylphenyl)carbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate |
| SMILES | Cc1ccc(NC(=O)[C@@]23C[C@H]2C=CCCCCC[C@H](OC(=O)NC(C)(C)C)C(=O)N2CCC[C@H]2C(=O)N3)cc1 |
| InChI | InChI=1S/C30H42N4O5/c1-20-14-16-22(17-15-20)31-27(37)30-19-21(30)11-8-6-5-7-9-13-24(39-28(38)33-29(2,3)4)26(36)34-18-10-12-23(34)25(35)32-30/h8,11,14-17,21,23-24H,5-7,9-10,12-13,18-19H2,1-4H3,(H,31,37)(H,32,35)(H,33,38)/t21-,23+,24+,30-/m1/s1 |
| InChIKey | QYAHZOFWOIXRED-XDRYYISASA-N |
| XLogP | 4.21 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|