C29H38Cl2N4O7S — CID 91472448
[(1S,4R,6S,14S)-4-[(3,5-dichlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate (PubChem CID 91472448) has the molecular formula C29H38Cl2N4O7S and a molecular weight of 657.62 g/mol. Its IUPAC name is [(1S,4R,6S,14S)-4-[(3,5-dichlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate.
| Compound Name | [(1S,4R,6S,14S)-4-[(3,5-dichlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91472448 |
| Molecular Formula | C29H38Cl2N4O7S |
| Molecular Weight | 657.62 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | [(1S,4R,6S,14S)-4-[(3,5-dichlorophenyl)sulfonylcarbamoyl]-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-14-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H]1CCCCCC=C[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)c2cc(Cl)cc(Cl)c2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C29H38Cl2N4O7S/c1-28(2,3)33-27(39)42-23-12-8-6-4-5-7-10-18-17-29(18,32-24(36)22-11-9-13-35(22)25(23)37)26(38)34-43(40,41)21-15-19(30)14-20(31)16-21/h7,10,14-16,18,22-23H,4-6,8-9,11-13,17H2,1-3H3,(H,32,36)(H,33,39)(H,34,38)/t18-,22+,23+,29-/m1/s1 |
| InChIKey | DVPSKXKFMVRQHJ-KBSQQMHRSA-N |
| XLogP | 4.08 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.62 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|